C17H20BN3O2 — CID 135997587
3-(1H-pyrrol-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole (PubChem CID 135997587) has the molecular formula C17H20BN3O2 and a molecular weight of 309.18 g/mol. Its IUPAC name is 3-(1H-pyrrol-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole.
| Compound Name | 3-(1H-pyrrol-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
|---|---|
| PubChem CID | 135997587 |
| Molecular Formula | C17H20BN3O2 |
| Molecular Weight | 309.18 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 3-(1H-pyrrol-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
| SMILES | CC1(C)OB(c2ccc3[nH]nc(-c4ccc[nH]4)c3c2)OC1(C)C |
| InChI | InChI=1S/C17H20BN3O2/c1-16(2)17(3,4)23-18(22-16)11-7-8-13-12(10-11)15(21-20-13)14-6-5-9-19-14/h5-10,19H,1-4H3,(H,20,21) |
| InChIKey | KKBJZPQMJRYVFY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 62.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.18 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|