C14H20BClN2O2 — CID 170911043
3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole;hydrochloride (PubChem CID 170911043) has the molecular formula C14H20BClN2O2 and a molecular weight of 294.59 g/mol. Its IUPAC name is 3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole;hydrochloride.
| Compound Name | 3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole;hydrochloride |
|---|---|
| PubChem CID | 170911043 |
| Molecular Formula | C14H20BClN2O2 |
| Molecular Weight | 294.59 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole;hydrochloride |
| SMILES | Cc1[nH]nc2cc(B3OC(C)(C)C(C)(C)O3)ccc12.Cl |
| InChI | InChI=1S/C14H19BN2O2.ClH/c1-9-11-7-6-10(8-12(11)17-16-9)15-18-13(2,3)14(4,5)19-15;/h6-8H,1-5H3,(H,16,17);1H |
| InChIKey | OLEQRFZQHNMEMJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.59 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|