C28H25BCl2N4O3 — CID 59436033
5-[2,6-dichloro-4-(1H-pyrrol-2-yl)anilino]-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzo[h][2,6]naphthyridin-1-one (PubChem CID 59436033) has the molecular formula C28H25BCl2N4O3 and a molecular weight of 547.25 g/mol. Its IUPAC name is 5-[2,6-dichloro-4-(1H-pyrrol-2-yl)anilino]-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzo[h][2,6]naphthyridin-1-one.
| Compound Name | 5-[2,6-dichloro-4-(1H-pyrrol-2-yl)anilino]-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzo[h][2,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 59436033 |
| Molecular Formula | C28H25BCl2N4O3 |
| Molecular Weight | 547.25 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | 5-[2,6-dichloro-4-(1H-pyrrol-2-yl)anilino]-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-benzo[h][2,6]naphthyridin-1-one |
| SMILES | CC1(C)OB(c2ccc3nc(Nc4c(Cl)cc(-c5ccc[nH]5)cc4Cl)c4cc[nH]c(=O)c4c3c2)OC1(C)C |
| InChI | InChI=1S/C28H25BCl2N4O3/c1-27(2)28(3,4)38-29(37-27)16-7-8-22-18(14-16)23-17(9-11-33-26(23)36)25(34-22)35-24-19(30)12-15(13-20(24)31)21-6-5-10-32-21/h5-14,32H,1-4H3,(H,33,36)(H,34,35) |
| InChIKey | HDOGXRAYEWOFFV-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.25 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|