C24H20BrN3O — CID 143777570
9-bromo-5-[2-[(1Z)-buta-1,3-dienyl]-3,6-dimethylanilino]-2H-benzo[h][2,6]naphthyridin-1-one (PubChem CID 143777570) has the molecular formula C24H20BrN3O and a molecular weight of 446.35 g/mol. Its IUPAC name is 9-bromo-5-[2-[(1Z)-buta-1,3-dienyl]-3,6-dimethylanilino]-2H-benzo[h][2,6]naphthyridin-1-one.
| Compound Name | 9-bromo-5-[2-[(1Z)-buta-1,3-dienyl]-3,6-dimethylanilino]-2H-benzo[h][2,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 143777570 |
| Molecular Formula | C24H20BrN3O |
| Molecular Weight | 446.35 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 9-bromo-5-[2-[(1Z)-buta-1,3-dienyl]-3,6-dimethylanilino]-2H-benzo[h][2,6]naphthyridin-1-one |
| SMILES | C=C/C=C\c1c(C)ccc(C)c1Nc1nc2ccc(Br)cc2c2c(=O)[nH]ccc12 |
| InChI | InChI=1S/C24H20BrN3O/c1-4-5-6-17-14(2)7-8-15(3)22(17)28-23-18-11-12-26-24(29)21(18)19-13-16(25)9-10-20(19)27-23/h4-13H,1H2,2-3H3,(H,26,29)(H,27,28)/b6-5- |
| InChIKey | OXUYUIWVBIQCLP-WAYWQWQTSA-N |
| XLogP | 6.40 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.35 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|