C23H22FN3O — CID 25227126
5-(5-tert-butyl-2-methylanilino)-9-fluoro-2H-benzo[h][2,6]naphthyridin-1-one (PubChem CID 25227126) has the molecular formula C23H22FN3O and a molecular weight of 375.45 g/mol. Its IUPAC name is 5-(5-tert-butyl-2-methylanilino)-9-fluoro-2H-benzo[h][2,6]naphthyridin-1-one.
| Compound Name | 5-(5-tert-butyl-2-methylanilino)-9-fluoro-2H-benzo[h][2,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 25227126 |
| Molecular Formula | C23H22FN3O |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 5-(5-tert-butyl-2-methylanilino)-9-fluoro-2H-benzo[h][2,6]naphthyridin-1-one |
| SMILES | Cc1ccc(C(C)(C)C)cc1Nc1nc2ccc(F)cc2c2c(=O)[nH]ccc12 |
| InChI | InChI=1S/C23H22FN3O/c1-13-5-6-14(23(2,3)4)11-19(13)27-21-16-9-10-25-22(28)20(16)17-12-15(24)7-8-18(17)26-21/h5-12H,1-4H3,(H,25,28)(H,26,27) |
| InChIKey | NPKVJVTXHFBNDO-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|