C20H16FN3O — CID 25096530
9-fluoro-6-[[(1S)-1-phenylethyl]amino]-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 25096530) has the molecular formula C20H16FN3O and a molecular weight of 333.37 g/mol. Its IUPAC name is 9-fluoro-6-[[(1S)-1-phenylethyl]amino]-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 9-fluoro-6-[[(1S)-1-phenylethyl]amino]-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 25096530 |
| Molecular Formula | C20H16FN3O |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 9-fluoro-6-[[(1S)-1-phenylethyl]amino]-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | C[C@H](Nc1nc2cc[nH]c(=O)c2c2cc(F)ccc12)c1ccccc1 |
| InChI | InChI=1S/C20H16FN3O/c1-12(13-5-3-2-4-6-13)23-19-15-8-7-14(21)11-16(15)18-17(24-19)9-10-22-20(18)25/h2-12H,1H3,(H,22,25)(H,23,24)/t12-/m0/s1 |
| InChIKey | TYYCOLZENOGAIT-LBPRGKRZSA-N |
| XLogP | 4.39 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|