C19H23N3OS — CID 145475364
6-(3,3-dimethylbutan-2-ylamino)-9-methylsulfanyl-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 145475364) has the molecular formula C19H23N3OS and a molecular weight of 341.48 g/mol. Its IUPAC name is 6-(3,3-dimethylbutan-2-ylamino)-9-methylsulfanyl-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 6-(3,3-dimethylbutan-2-ylamino)-9-methylsulfanyl-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 145475364 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 6-(3,3-dimethylbutan-2-ylamino)-9-methylsulfanyl-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | CSc1ccc2c(NC(C)C(C)(C)C)nc3cc[nH]c(=O)c3c2c1 |
| InChI | InChI=1S/C19H23N3OS/c1-11(19(2,3)4)21-17-13-7-6-12(24-5)10-14(13)16-15(22-17)8-9-20-18(16)23/h6-11H,1-5H3,(H,20,23)(H,21,22) |
| InChIKey | SXDPMOOAJILNHF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|