C19H23FN4O — CID 25096274
6-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 25096274) has the molecular formula C19H23FN4O and a molecular weight of 342.42 g/mol. Its IUPAC name is 6-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 6-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 25096274 |
| Molecular Formula | C19H23FN4O |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 6-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | CN(C)CC(C)(C)CNc1nc2cc[nH]c(=O)c2c2cc(F)ccc12 |
| InChI | InChI=1S/C19H23FN4O/c1-19(2,11-24(3)4)10-22-17-13-6-5-12(20)9-14(13)16-15(23-17)7-8-21-18(16)25/h5-9H,10-11H2,1-4H3,(H,21,25)(H,22,23) |
| InChIKey | DDENGOKBDROKPS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|