C18H17N5O — CID 25098080
6-(ethylamino)-9-(1-methylpyrazol-4-yl)-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 25098080) has the molecular formula C18H17N5O and a molecular weight of 319.37 g/mol. Its IUPAC name is 6-(ethylamino)-9-(1-methylpyrazol-4-yl)-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 6-(ethylamino)-9-(1-methylpyrazol-4-yl)-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 25098080 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 6-(ethylamino)-9-(1-methylpyrazol-4-yl)-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | CCNc1nc2cc[nH]c(=O)c2c2cc(-c3cnn(C)c3)ccc12 |
| InChI | InChI=1S/C18H17N5O/c1-3-19-17-13-5-4-11(12-9-21-23(2)10-12)8-14(13)16-15(22-17)6-7-20-18(16)24/h4-10H,3H2,1-2H3,(H,19,22)(H,20,24) |
| InChIKey | FBJRSHBOEAIJPZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|