C23H24N6O — CID 145475402
6-[[(Z)-2-(ethylideneamino)pent-2-enyl]amino]-9-(1-methylpyrazol-4-yl)-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 145475402) has the molecular formula C23H24N6O and a molecular weight of 400.49 g/mol. Its IUPAC name is 6-[[(Z)-2-(ethylideneamino)pent-2-enyl]amino]-9-(1-methylpyrazol-4-yl)-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 6-[[(Z)-2-(ethylideneamino)pent-2-enyl]amino]-9-(1-methylpyrazol-4-yl)-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 145475402 |
| Molecular Formula | C23H24N6O |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 6-[[(Z)-2-(ethylideneamino)pent-2-enyl]amino]-9-(1-methylpyrazol-4-yl)-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | C/C=N/C(=C\CC)CNc1nc2cc[nH]c(=O)c2c2cc(-c3cnn(C)c3)ccc12 |
| InChI | InChI=1S/C23H24N6O/c1-4-6-17(24-5-2)13-26-22-18-8-7-15(16-12-27-29(3)14-16)11-19(18)21-20(28-22)9-10-25-23(21)30/h5-12,14H,4,13H2,1-3H3,(H,25,30)(H,26,28)/b17-6-,24-5+ |
| InChIKey | HGQRHIFECIJYEC-XBBKMMLOSA-N |
| XLogP | 4.27 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|