C19H19N5O — CID 145475411
9-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-6-(cyclopropylamino)-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 145475411) has the molecular formula C19H19N5O and a molecular weight of 333.40 g/mol. Its IUPAC name is 9-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-6-(cyclopropylamino)-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 9-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-6-(cyclopropylamino)-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 145475411 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 9-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-6-(cyclopropylamino)-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | C/N=C/C(=C\N)c1ccc2c(NC3CC3)nc3cc[nH]c(=O)c3c2c1 |
| InChI | InChI=1S/C19H19N5O/c1-21-10-12(9-20)11-2-5-14-15(8-11)17-16(6-7-22-19(17)25)24-18(14)23-13-3-4-13/h2,5-10,13H,3-4,20H2,1H3,(H,22,25)(H,23,24)/b12-9+,21-10+ |
| InChIKey | FQANVCYEHOTMEO-GNHRLDPLSA-N |
| XLogP | 2.65 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|