C20H18F2N4O — CID 145475388
9-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-6-(3,3-difluorocyclobutyl)-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 145475388) has the molecular formula C20H18F2N4O and a molecular weight of 368.39 g/mol. Its IUPAC name is 9-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-6-(3,3-difluorocyclobutyl)-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 9-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-6-(3,3-difluorocyclobutyl)-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 145475388 |
| Molecular Formula | C20H18F2N4O |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 9-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-6-(3,3-difluorocyclobutyl)-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | C/N=C/C(=C\N)c1ccc2c(C3CC(F)(F)C3)nc3cc[nH]c(=O)c3c2c1 |
| InChI | InChI=1S/C20H18F2N4O/c1-24-10-13(9-23)11-2-3-14-15(6-11)17-16(4-5-25-19(17)27)26-18(14)12-7-20(21,22)8-12/h2-6,9-10,12H,7-8,23H2,1H3,(H,25,27)/b13-9+,24-10+ |
| InChIKey | UJSQDJZXMGBPRZ-PSGJIKNWSA-N |
| XLogP | 3.59 |
| TPSA | 84.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|