C20H25N5O — CID 145475403
9-[(Z)-1,2-diaminoethenyl]-6-(3,3-dimethylbutan-2-ylamino)-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 145475403) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is 9-[(Z)-1,2-diaminoethenyl]-6-(3,3-dimethylbutan-2-ylamino)-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 9-[(Z)-1,2-diaminoethenyl]-6-(3,3-dimethylbutan-2-ylamino)-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 145475403 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 9-[(Z)-1,2-diaminoethenyl]-6-(3,3-dimethylbutan-2-ylamino)-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | CC(Nc1nc2cc[nH]c(=O)c2c2cc(/C(N)=C/N)ccc12)C(C)(C)C |
| InChI | InChI=1S/C20H25N5O/c1-11(20(2,3)4)24-18-13-6-5-12(15(22)10-21)9-14(13)17-16(25-18)7-8-23-19(17)26/h5-11H,21-22H2,1-4H3,(H,23,26)(H,24,25)/b15-10- |
| InChIKey | XPJHJZHOZLNONO-GDNBJRDFSA-N |
| XLogP | 3.14 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|