C21H24FN5O — CID 145475404
4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-6-(3,3-dimethylbutan-2-ylamino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 145475404) has the molecular formula C21H24FN5O and a molecular weight of 381.46 g/mol. Its IUPAC name is 4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-6-(3,3-dimethylbutan-2-ylamino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-6-(3,3-dimethylbutan-2-ylamino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 145475404 |
| Molecular Formula | C21H24FN5O |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-6-(3,3-dimethylbutan-2-ylamino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | [H]/N=C/C(=C\N)c1c[nH]c(=O)c2c1nc(NC(C)C(C)(C)C)c1ccc(F)cc12 |
| InChI | InChI=1S/C21H24FN5O/c1-11(21(2,3)4)26-19-14-6-5-13(22)7-15(14)17-18(27-19)16(10-25-20(17)28)12(8-23)9-24/h5-11,23H,24H2,1-4H3,(H,25,28)(H,26,27)/b12-9+,23-8+ |
| InChIKey | GONINHTWGITNEV-YBRLYULZSA-N |
| XLogP | 4.01 |
| TPSA | 107.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|