C23H23BrN4O — CID 70878034
9-bromo-6-(3,3-dimethylbutan-2-ylamino)-4-pyridin-3-yl-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 70878034) has the molecular formula C23H23BrN4O and a molecular weight of 451.37 g/mol. Its IUPAC name is 9-bromo-6-(3,3-dimethylbutan-2-ylamino)-4-pyridin-3-yl-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 9-bromo-6-(3,3-dimethylbutan-2-ylamino)-4-pyridin-3-yl-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 70878034 |
| Molecular Formula | C23H23BrN4O |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 9-bromo-6-(3,3-dimethylbutan-2-ylamino)-4-pyridin-3-yl-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | CC(Nc1nc2c(-c3cccnc3)c[nH]c(=O)c2c2cc(Br)ccc12)C(C)(C)C |
| InChI | InChI=1S/C23H23BrN4O/c1-13(23(2,3)4)27-21-16-8-7-15(24)10-17(16)19-20(28-21)18(12-26-22(19)29)14-6-5-9-25-11-14/h5-13H,1-4H3,(H,26,29)(H,27,28) |
| InChIKey | DKCUXECZTQHYLP-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|