C24H27N5O — CID 70878020
4-cyclopropyl-6-[[(2R)-3,3-dimethylbutan-2-yl]amino]-9-(1H-pyrazol-4-yl)-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 70878020) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is 4-cyclopropyl-6-[[(2R)-3,3-dimethylbutan-2-yl]amino]-9-(1H-pyrazol-4-yl)-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 4-cyclopropyl-6-[[(2R)-3,3-dimethylbutan-2-yl]amino]-9-(1H-pyrazol-4-yl)-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 70878020 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 4-cyclopropyl-6-[[(2R)-3,3-dimethylbutan-2-yl]amino]-9-(1H-pyrazol-4-yl)-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | C[C@@H](Nc1nc2c(C3CC3)c[nH]c(=O)c2c2cc(-c3cn[nH]c3)ccc12)C(C)(C)C |
| InChI | InChI=1S/C24H27N5O/c1-13(24(2,3)4)28-22-17-8-7-15(16-10-26-27-11-16)9-18(17)20-21(29-22)19(14-5-6-14)12-25-23(20)30/h7-14H,5-6H2,1-4H3,(H,25,30)(H,26,27)(H,28,29)/t13-/m1/s1 |
| InChIKey | RIVMLLCDJOIDDH-CYBMUJFWSA-N |
| XLogP | 5.19 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|