C24H25N3O3 — CID 59375506
6-(3,3-dimethylbutan-2-ylamino)-4,9-bis(3-hydroxyprop-1-ynyl)-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 59375506) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 6-(3,3-dimethylbutan-2-ylamino)-4,9-bis(3-hydroxyprop-1-ynyl)-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 6-(3,3-dimethylbutan-2-ylamino)-4,9-bis(3-hydroxyprop-1-ynyl)-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 59375506 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 6-(3,3-dimethylbutan-2-ylamino)-4,9-bis(3-hydroxyprop-1-ynyl)-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | CC(Nc1nc2c(C#CCO)c[nH]c(=O)c2c2cc(C#CCO)ccc12)C(C)(C)C |
| InChI | InChI=1S/C24H25N3O3/c1-15(24(2,3)4)26-22-18-10-9-16(7-5-11-28)13-19(18)20-21(27-22)17(8-6-12-29)14-25-23(20)30/h9-10,13-15,28-29H,11-12H2,1-4H3,(H,25,30)(H,26,27) |
| InChIKey | PXCNCCGYZXPTBQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|