C27H27F3N4O2 — CID 59375544
9-(4-morpholin-4-ylphenyl)-6-[[(2R)-1,1,1-trifluoro-3-methylbutan-2-yl]amino]-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 59375544) has the molecular formula C27H27F3N4O2 and a molecular weight of 496.53 g/mol. Its IUPAC name is 9-(4-morpholin-4-ylphenyl)-6-[[(2R)-1,1,1-trifluoro-3-methylbutan-2-yl]amino]-2H-benzo[c][1,6]naphthyridin-1-one.
| Compound Name | 9-(4-morpholin-4-ylphenyl)-6-[[(2R)-1,1,1-trifluoro-3-methylbutan-2-yl]amino]-2H-benzo[c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 59375544 |
| Molecular Formula | C27H27F3N4O2 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 9-(4-morpholin-4-ylphenyl)-6-[[(2R)-1,1,1-trifluoro-3-methylbutan-2-yl]amino]-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | CC(C)[C@@H](Nc1nc2cc[nH]c(=O)c2c2cc(-c3ccc(N4CCOCC4)cc3)ccc12)C(F)(F)F |
| InChI | InChI=1S/C27H27F3N4O2/c1-16(2)24(27(28,29)30)33-25-20-8-5-18(15-21(20)23-22(32-25)9-10-31-26(23)35)17-3-6-19(7-4-17)34-11-13-36-14-12-34/h3-10,15-16,24H,11-14H2,1-2H3,(H,31,35)(H,32,33)/t24-/m1/s1 |
| InChIKey | GEVSMUIPYKBKTB-XMMPIXPASA-N |
| XLogP | 5.58 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|