C23H27F3N5O3+ — CID 91572459
2-[4-[1-oxo-6-[[(2R)-1,1,1-trifluoro-3-methylbutan-2-yl]amino]-2H-benzo[c][1,6]naphthyridin-9-yl]morpholin-4-ium-4-yl]acetamide (PubChem CID 91572459) has the molecular formula C23H27F3N5O3+ and a molecular weight of 478.50 g/mol. Its IUPAC name is 2-[4-[1-oxo-6-[[(2R)-1,1,1-trifluoro-3-methylbutan-2-yl]amino]-2H-benzo[c][1,6]naphthyridin-9-yl]morpholin-4-ium-4-yl]acetamide.
| Compound Name | 2-[4-[1-oxo-6-[[(2R)-1,1,1-trifluoro-3-methylbutan-2-yl]amino]-2H-benzo[c][1,6]naphthyridin-9-yl]morpholin-4-ium-4-yl]acetamide |
|---|---|
| PubChem CID | 91572459 |
| Molecular Formula | C23H27F3N5O3+ |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 2-[4-[1-oxo-6-[[(2R)-1,1,1-trifluoro-3-methylbutan-2-yl]amino]-2H-benzo[c][1,6]naphthyridin-9-yl]morpholin-4-ium-4-yl]acetamide |
| SMILES | CC(C)[C@@H](Nc1nc2cc[nH]c(=O)c2c2cc([N+]3(CC(N)=O)CCOCC3)ccc12)C(F)(F)F |
| InChI | InChI=1S/C23H26F3N5O3/c1-13(2)20(23(24,25)26)30-21-15-4-3-14(31(12-18(27)32)7-9-34-10-8-31)11-16(15)19-17(29-21)5-6-28-22(19)33/h3-6,11,13,20H,7-10,12H2,1-2H3,(H3-,27,28,29,30,32,33)/p+1/t20-/m1/s1 |
| InChIKey | YHDYIYUJPAKTCA-HXUWFJFHSA-O |
| XLogP | 2.90 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|