C22H26N4O — CID 168926633
(Z)-2-[1-(4-methoxycyclohexyl)-3H-pyrrolo[2,3-c]isoquinolin-8-yl]-3-methyliminoprop-1-en-1-amine (PubChem CID 168926633) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is (Z)-2-[1-(4-methoxycyclohexyl)-3H-pyrrolo[2,3-c]isoquinolin-8-yl]-3-methyliminoprop-1-en-1-amine.
| Compound Name | (Z)-2-[1-(4-methoxycyclohexyl)-3H-pyrrolo[2,3-c]isoquinolin-8-yl]-3-methyliminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 168926633 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (Z)-2-[1-(4-methoxycyclohexyl)-3H-pyrrolo[2,3-c]isoquinolin-8-yl]-3-methyliminoprop-1-en-1-amine |
| SMILES | C/N=C/C(=C\N)c1ccc2cnc3[nH]cc(C4CCC(OC)CC4)c3c2c1 |
| InChI | InChI=1S/C22H26N4O/c1-24-11-17(10-23)15-3-4-16-12-25-22-21(19(16)9-15)20(13-26-22)14-5-7-18(27-2)8-6-14/h3-4,9-14,18H,5-8,23H2,1-2H3,(H,25,26)/b17-10+,24-11+ |
| InChIKey | WAFRNQJPQMKHBG-BUGDWOBSSA-N |
| XLogP | 4.39 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|