C10H11N3O2 — CID 143834642
5-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]pyridine-2-carboxylic acid (PubChem CID 143834642) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 5-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]pyridine-2-carboxylic acid.
| Compound Name | 5-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 143834642 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 5-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]pyridine-2-carboxylic acid |
| SMILES | C/N=C/C(=C\N)c1ccc(C(=O)O)nc1 |
| InChI | InChI=1S/C10H11N3O2/c1-12-5-8(4-11)7-2-3-9(10(14)15)13-6-7/h2-6H,11H2,1H3,(H,14,15)/b8-4+,12-5+ |
| InChIKey | DGGINDVVQQSUPW-FWSLBAKWSA-N |
| XLogP | 0.78 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|