C14H19N3 — CID 174041792
3-methylimino-2-[4-methyl-3-[(Z)-2-(methylamino)ethenyl]phenyl]prop-1-en-1-amine (PubChem CID 174041792) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 3-methylimino-2-[4-methyl-3-[(Z)-2-(methylamino)ethenyl]phenyl]prop-1-en-1-amine.
| Compound Name | 3-methylimino-2-[4-methyl-3-[(Z)-2-(methylamino)ethenyl]phenyl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 174041792 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 3-methylimino-2-[4-methyl-3-[(Z)-2-(methylamino)ethenyl]phenyl]prop-1-en-1-amine |
| SMILES | C/N=C/C(=CN)c1ccc(C)c(/C=C\NC)c1 |
| InChI | InChI=1S/C14H19N3/c1-11-4-5-13(14(9-15)10-17-3)8-12(11)6-7-16-2/h4-10,16H,15H2,1-3H3/b7-6-,14-9?,17-10+ |
| InChIKey | UKZVTKXLTSWJKH-WMTJXLFNSA-N |
| XLogP | 2.19 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|