C11H14N4O — CID 170633763
(Z)-2-amino-2-[5-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-2-pyridinyl]ethenol (PubChem CID 170633763) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is (Z)-2-amino-2-[5-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-2-pyridinyl]ethenol.
| Compound Name | (Z)-2-amino-2-[5-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-2-pyridinyl]ethenol |
|---|---|
| PubChem CID | 170633763 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | (Z)-2-amino-2-[5-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-2-pyridinyl]ethenol |
| SMILES | C/N=C/C(=C\N)c1ccc(/C(N)=C/O)nc1 |
| InChI | InChI=1S/C11H14N4O/c1-14-5-9(4-12)8-2-3-11(15-6-8)10(13)7-16/h2-7,16H,12-13H2,1H3/b9-4+,10-7-,14-5+ |
| InChIKey | AARSTUHUBMGJHF-YWQKXOJUSA-N |
| XLogP | 0.90 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|