C21H23N7O — CID 156661924
4-[4-[6-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]indazol-1-yl]-2-pyridinyl]-1-methylpiperazin-2-one (PubChem CID 156661924) has the molecular formula C21H23N7O and a molecular weight of 389.46 g/mol. Its IUPAC name is 4-[4-[6-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]indazol-1-yl]-2-pyridinyl]-1-methylpiperazin-2-one.
| Compound Name | 4-[4-[6-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]indazol-1-yl]-2-pyridinyl]-1-methylpiperazin-2-one |
|---|---|
| PubChem CID | 156661924 |
| Molecular Formula | C21H23N7O |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 4-[4-[6-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]indazol-1-yl]-2-pyridinyl]-1-methylpiperazin-2-one |
| SMILES | C/N=C/C(=C\N)c1ccc2cnn(-c3ccnc(N4CCN(C)C(=O)C4)c3)c2c1 |
| InChI | InChI=1S/C21H23N7O/c1-23-12-17(11-22)15-3-4-16-13-25-28(19(16)9-15)18-5-6-24-20(10-18)27-8-7-26(2)21(29)14-27/h3-6,9-13H,7-8,14,22H2,1-2H3/b17-11+,23-12+ |
| InChIKey | QLGYFHGVNSOONB-ZSZRBZNDSA-N |
| XLogP | 1.70 |
| TPSA | 92.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|