C21H25N7 — CID 156661933
(Z)-3-methylimino-2-[1-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]indazol-6-yl]prop-1-en-1-amine (PubChem CID 156661933) has the molecular formula C21H25N7 and a molecular weight of 375.48 g/mol. Its IUPAC name is (Z)-3-methylimino-2-[1-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]indazol-6-yl]prop-1-en-1-amine.
| Compound Name | (Z)-3-methylimino-2-[1-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]indazol-6-yl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 156661933 |
| Molecular Formula | C21H25N7 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (Z)-3-methylimino-2-[1-[2-(4-methylpiperazin-1-yl)-4-pyridinyl]indazol-6-yl]prop-1-en-1-amine |
| SMILES | C/N=C/C(=C\N)c1ccc2cnn(-c3ccnc(N4CCN(C)CC4)c3)c2c1 |
| InChI | InChI=1S/C21H25N7/c1-23-14-18(13-22)16-3-4-17-15-25-28(20(17)11-16)19-5-6-24-21(12-19)27-9-7-26(2)8-10-27/h3-6,11-15H,7-10,22H2,1-2H3/b18-13+,23-14+ |
| InChIKey | UOLSAMMGWAFWNX-NXUONHHFSA-N |
| XLogP | 2.17 |
| TPSA | 75.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|