C20H25N5O3 — CID 143530580
4-[5-[(Z)-2-amino-1-(2-amino-4,5-dimethoxyphenyl)ethenyl]-2-pyridinyl]-1-methylpiperazin-2-one (PubChem CID 143530580) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-[5-[(Z)-2-amino-1-(2-amino-4,5-dimethoxyphenyl)ethenyl]-2-pyridinyl]-1-methylpiperazin-2-one.
| Compound Name | 4-[5-[(Z)-2-amino-1-(2-amino-4,5-dimethoxyphenyl)ethenyl]-2-pyridinyl]-1-methylpiperazin-2-one |
|---|---|
| PubChem CID | 143530580 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 4-[5-[(Z)-2-amino-1-(2-amino-4,5-dimethoxyphenyl)ethenyl]-2-pyridinyl]-1-methylpiperazin-2-one |
| SMILES | COc1cc(N)c(/C(=C\N)c2ccc(N3CCN(C)C(=O)C3)nc2)cc1OC |
| InChI | InChI=1S/C20H25N5O3/c1-24-6-7-25(12-20(24)26)19-5-4-13(11-23-19)15(10-21)14-8-17(27-2)18(28-3)9-16(14)22/h4-5,8-11H,6-7,12,21-22H2,1-3H3/b15-10- |
| InChIKey | UHYJZXQCDZQJEC-GDNBJRDFSA-N |
| XLogP | 1.31 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|