C12H16N4O3 — CID 114090414
methyl 5-amino-2-(4-methyl-3-oxopiperazin-1-yl)pyridine-4-carboxylate (PubChem CID 114090414) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is methyl 5-amino-2-(4-methyl-3-oxopiperazin-1-yl)pyridine-4-carboxylate.
| Compound Name | methyl 5-amino-2-(4-methyl-3-oxopiperazin-1-yl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 114090414 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | methyl 5-amino-2-(4-methyl-3-oxopiperazin-1-yl)pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(N2CCN(C)C(=O)C2)ncc1N |
| InChI | InChI=1S/C12H16N4O3/c1-15-3-4-16(7-11(15)17)10-5-8(12(18)19-2)9(13)6-14-10/h5-6H,3-4,7,13H2,1-2H3 |
| InChIKey | WACZFDUDBCUZPF-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |