C19H25FN4O2 — CID 143530604
2-[(Z)-2-amino-1-[6-(3-fluoroazetidin-1-yl)-3-pyridinyl]ethenyl]-5-methoxyaniline;methoxymethane (PubChem CID 143530604) has the molecular formula C19H25FN4O2 and a molecular weight of 360.43 g/mol. Its IUPAC name is 2-[(Z)-2-amino-1-[6-(3-fluoroazetidin-1-yl)-3-pyridinyl]ethenyl]-5-methoxyaniline;methoxymethane.
| Compound Name | 2-[(Z)-2-amino-1-[6-(3-fluoroazetidin-1-yl)-3-pyridinyl]ethenyl]-5-methoxyaniline;methoxymethane |
|---|---|
| PubChem CID | 143530604 |
| Molecular Formula | C19H25FN4O2 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 2-[(Z)-2-amino-1-[6-(3-fluoroazetidin-1-yl)-3-pyridinyl]ethenyl]-5-methoxyaniline;methoxymethane |
| SMILES | COC.COc1ccc(/C(=C\N)c2ccc(N3CC(F)C3)nc2)c(N)c1 |
| InChI | InChI=1S/C17H19FN4O.C2H6O/c1-23-13-3-4-14(16(20)6-13)15(7-19)11-2-5-17(21-8-11)22-9-12(18)10-22;1-3-2/h2-8,12H,9-10,19-20H2,1H3;1-2H3/b15-7-; |
| InChIKey | YZIHHFBSOBFHND-DFPPEFKWSA-N |
| XLogP | 2.44 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|