C12H14N4OS — CID 164769374
4-[1-(5-methoxy-2-pyridinyl)azetidin-3-yl]-1,3-thiazol-2-amine (PubChem CID 164769374) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is 4-[1-(5-methoxy-2-pyridinyl)azetidin-3-yl]-1,3-thiazol-2-amine.
| Compound Name | 4-[1-(5-methoxy-2-pyridinyl)azetidin-3-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 164769374 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 4-[1-(5-methoxy-2-pyridinyl)azetidin-3-yl]-1,3-thiazol-2-amine |
| SMILES | COc1ccc(N2CC(c3csc(N)n3)C2)nc1 |
| InChI | InChI=1S/C12H14N4OS/c1-17-9-2-3-11(14-4-9)16-5-8(6-16)10-7-18-12(13)15-10/h2-4,7-8H,5-6H2,1H3,(H2,13,15) |
| InChIKey | YFRSVQNHIJKJIH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |