C12H13N5O — CID 176524176
(3Z)-3-[5-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-2-pyridinyl]-3-hydrazinylideneprop-1-en-1-one (PubChem CID 176524176) has the molecular formula C12H13N5O and a molecular weight of 243.27 g/mol. Its IUPAC name is (3Z)-3-[5-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-2-pyridinyl]-3-hydrazinylideneprop-1-en-1-one.
| Compound Name | (3Z)-3-[5-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-2-pyridinyl]-3-hydrazinylideneprop-1-en-1-one |
|---|---|
| PubChem CID | 176524176 |
| Molecular Formula | C12H13N5O |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | (3Z)-3-[5-[(Z)-1-amino-3-methyliminoprop-1-en-2-yl]-2-pyridinyl]-3-hydrazinylideneprop-1-en-1-one |
| SMILES | C/N=C/C(=C\N)c1ccc(/C(C=C=O)=N\N)nc1 |
| InChI | InChI=1S/C12H13N5O/c1-15-7-10(6-13)9-2-3-11(16-8-9)12(17-14)4-5-18/h2-4,6-8H,13-14H2,1H3/b10-6+,15-7+,17-12- |
| InChIKey | VZBKAIFKBQMARV-IOKSVMTPSA-N |
| XLogP | 0.13 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|