C22H26N8O3 — CID 170633975
N-[5-[[(2E)-2-[5-[(Z)-1-amino-3-(oxetan-3-ylimino)prop-1-en-2-yl]-2-pyridinyl]-2-hydrazinylideneacetyl]amino]-6-methyl-3-pyridinyl]propanamide (PubChem CID 170633975) has the molecular formula C22H26N8O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-[5-[[(2E)-2-[5-[(Z)-1-amino-3-(oxetan-3-ylimino)prop-1-en-2-yl]-2-pyridinyl]-2-hydrazinylideneacetyl]amino]-6-methyl-3-pyridinyl]propanamide.
| Compound Name | N-[5-[[(2E)-2-[5-[(Z)-1-amino-3-(oxetan-3-ylimino)prop-1-en-2-yl]-2-pyridinyl]-2-hydrazinylideneacetyl]amino]-6-methyl-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 170633975 |
| Molecular Formula | C22H26N8O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | N-[5-[[(2E)-2-[5-[(Z)-1-amino-3-(oxetan-3-ylimino)prop-1-en-2-yl]-2-pyridinyl]-2-hydrazinylideneacetyl]amino]-6-methyl-3-pyridinyl]propanamide |
| SMILES | CCC(=O)Nc1cnc(C)c(NC(=O)/C(=N/N)c2ccc(C(=C/N)/C=N/C3COC3)cn2)c1 |
| InChI | InChI=1S/C22H26N8O3/c1-3-20(31)28-16-6-19(13(2)25-10-16)29-22(32)21(30-24)18-5-4-14(8-27-18)15(7-23)9-26-17-11-33-12-17/h4-10,17H,3,11-12,23-24H2,1-2H3,(H,28,31)(H,29,32)/b15-7+,26-9+,30-21+ |
| InChIKey | HZVSYYBHJKSDPR-HBDBKCEDSA-N |
| XLogP | 1.20 |
| TPSA | 169.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|