C17H16N6 — CID 144666582
7-(1-amino-3-methyliminoprop-1-en-2-yl)-N-pyridin-3-yl-1,5-naphthyridin-2-amine (PubChem CID 144666582) has the molecular formula C17H16N6 and a molecular weight of 304.36 g/mol. Its IUPAC name is 7-(1-amino-3-methyliminoprop-1-en-2-yl)-N-pyridin-3-yl-1,5-naphthyridin-2-amine.
| Compound Name | 7-(1-amino-3-methyliminoprop-1-en-2-yl)-N-pyridin-3-yl-1,5-naphthyridin-2-amine |
|---|---|
| PubChem CID | 144666582 |
| Molecular Formula | C17H16N6 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 7-(1-amino-3-methyliminoprop-1-en-2-yl)-N-pyridin-3-yl-1,5-naphthyridin-2-amine |
| SMILES | C/N=C/C(=CN)c1cnc2ccc(Nc3cccnc3)nc2c1 |
| InChI | InChI=1S/C17H16N6/c1-19-9-13(8-18)12-7-16-15(21-10-12)4-5-17(23-16)22-14-3-2-6-20-11-14/h2-11H,18H2,1H3,(H,22,23)/b13-8?,19-9+ |
| InChIKey | HPVNVUHSWCJJAU-IIYYVHRISA-N |
| XLogP | 2.77 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|