C26H32F2N8 — CID 162614875
7-[1-amino-3-[3-(4,4-difluoropiperidin-1-yl)propylimino]prop-1-en-2-yl]-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine (PubChem CID 162614875) has the molecular formula C26H32F2N8 and a molecular weight of 494.59 g/mol. Its IUPAC name is 7-[1-amino-3-[3-(4,4-difluoropiperidin-1-yl)propylimino]prop-1-en-2-yl]-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine.
| Compound Name | 7-[1-amino-3-[3-(4,4-difluoropiperidin-1-yl)propylimino]prop-1-en-2-yl]-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine |
|---|---|
| PubChem CID | 162614875 |
| Molecular Formula | C26H32F2N8 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 7-[1-amino-3-[3-(4,4-difluoropiperidin-1-yl)propylimino]prop-1-en-2-yl]-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine |
| SMILES | CC(C)c1cnnc(Nc2ccc3ncc(C(=CN)/C=N/CCCN4CCC(F)(F)CC4)cc3n2)c1 |
| InChI | InChI=1S/C26H32F2N8/c1-18(2)19-13-25(35-32-17-19)34-24-5-4-22-23(33-24)12-20(16-31-22)21(14-29)15-30-8-3-9-36-10-6-26(27,28)7-11-36/h4-5,12-18H,3,6-11,29H2,1-2H3,(H,33,34,35)/b21-14?,30-15+ |
| InChIKey | KSLJHZWDWLRYDU-RXIORKKLSA-N |
| XLogP | 4.78 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|