C26H34N8O — CID 147945532
7-[3-amino-1-[3-(3-methoxyazetidin-1-yl)propylimino]but-2-en-2-yl]-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine (PubChem CID 147945532) has the molecular formula C26H34N8O and a molecular weight of 474.61 g/mol. Its IUPAC name is 7-[3-amino-1-[3-(3-methoxyazetidin-1-yl)propylimino]but-2-en-2-yl]-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine.
| Compound Name | 7-[3-amino-1-[3-(3-methoxyazetidin-1-yl)propylimino]but-2-en-2-yl]-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine |
|---|---|
| PubChem CID | 147945532 |
| Molecular Formula | C26H34N8O |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | 7-[3-amino-1-[3-(3-methoxyazetidin-1-yl)propylimino]but-2-en-2-yl]-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine |
| SMILES | COC1CN(CCC/N=C/C(=C(C)N)c2cnc3ccc(Nc4cc(C(C)C)cnn4)nc3c2)C1 |
| InChI | InChI=1S/C26H34N8O/c1-17(2)19-11-26(33-30-13-19)32-25-7-6-23-24(31-25)10-20(12-29-23)22(18(3)27)14-28-8-5-9-34-15-21(16-34)35-4/h6-7,10-14,17,21H,5,8-9,15-16,27H2,1-4H3,(H,31,32,33)/b22-18?,28-14+ |
| InChIKey | KWIJYLBXVYAVJF-ZPTBJFLSSA-N |
| XLogP | 3.77 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|