C20H23N7 — CID 144665115
7-[(Z)-2-amino-4-iminopent-2-en-3-yl]-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine (PubChem CID 144665115) has the molecular formula C20H23N7 and a molecular weight of 361.45 g/mol. Its IUPAC name is 7-[(Z)-2-amino-4-iminopent-2-en-3-yl]-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine.
| Compound Name | 7-[(Z)-2-amino-4-iminopent-2-en-3-yl]-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine |
|---|---|
| PubChem CID | 144665115 |
| Molecular Formula | C20H23N7 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 7-[(Z)-2-amino-4-iminopent-2-en-3-yl]-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine |
| SMILES | [H]/N=C(C)/C(=C(/C)N)c1cnc2ccc(Nc3cc(C(C)C)cnn3)nc2c1 |
| InChI | InChI=1S/C20H23N7/c1-11(2)14-8-19(27-24-10-14)26-18-6-5-16-17(25-18)7-15(9-23-16)20(12(3)21)13(4)22/h5-11,21H,22H2,1-4H3,(H,25,26,27)/b20-13+,21-12+ |
| InChIKey | BZXXFKVQMAKDAU-KVDUHBSMSA-N |
| XLogP | 4.02 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|