About 7-piperidin-1-yl-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine
7-piperidin-1-yl-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine (PubChem CID 90289299) has the molecular formula C20H24N6
and a molecular weight of 348.45 g/mol. Its IUPAC name is 7-piperidin-1-yl-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine.
Molecular Properties
| Compound Name | 7-piperidin-1-yl-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine |
| PubChem CID | 90289299 |
| Molecular Formula | C20H24N6 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 7-piperidin-1-yl-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine |
| SMILES | CC(C)c1cnnc(Nc2ccc3ncc(N4CCCCC4)cc3n2)c1 |
| InChI | InChI=1S/C20H24N6/c1-14(2)15-10-20(25-22-12-15)24-19-7-6-17-18(23-19)11-16(13-21-17)26-8-4-3-5-9-26/h6-7,10-14H,3-5,8-9H2,1-2H3,(H,23,24,25) |
| InChIKey | OESJPTQLYQVPOZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-piperidin-1-yl-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-piperidin-1-yl-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine?
The IUPAC name of 7-piperidin-1-yl-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine (CID 90289299) is 7-piperidin-1-yl-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine.
What is the SMILES notation for 7-piperidin-1-yl-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine?
The canonical SMILES for 7-piperidin-1-yl-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine is CC(C)c1cnnc(Nc2ccc3ncc(N4CCCCC4)cc3n2)c1.
What is the InChIKey of 7-piperidin-1-yl-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine?
The InChIKey is OESJPTQLYQVPOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N6/c1-14(2)15-10-20(25-22-12-15)24-19-7-6-17-18(23-19)11-16(13-21-17)26-8-4-3-5-9-26/h6-7,10-14H,3-5,8-9H2,1-2H3,(H,23,24,25).
What are the key properties of 7-piperidin-1-yl-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine?
7-piperidin-1-yl-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine has a molecular weight of 348.45 g/mol, XLogP of 4.28, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-piperidin-1-yl-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine is sourced from PubChem (CID 90289299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).