About 7-(3-methylmorpholin-4-yl)-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine
7-(3-methylmorpholin-4-yl)-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine (PubChem CID 118497517) has the molecular formula C20H24N6O
and a molecular weight of 364.45 g/mol. Its IUPAC name is 7-(3-methylmorpholin-4-yl)-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine.
Molecular Properties
| Compound Name | 7-(3-methylmorpholin-4-yl)-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine |
| PubChem CID | 118497517 |
| Molecular Formula | C20H24N6O |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 7-(3-methylmorpholin-4-yl)-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine |
| SMILES | CC(C)c1cnnc(Nc2ccc3ncc(N4CCOCC4C)cc3n2)c1 |
| InChI | InChI=1S/C20H24N6O/c1-13(2)15-8-20(25-22-10-15)24-19-5-4-17-18(23-19)9-16(11-21-17)26-6-7-27-12-14(26)3/h4-5,8-11,13-14H,6-7,12H2,1-3H3,(H,23,24,25) |
| InChIKey | WNVTUOMRZWNUPW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 76.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-(3-methylmorpholin-4-yl)-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-methylmorpholin-4-yl)-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine?
The IUPAC name of 7-(3-methylmorpholin-4-yl)-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine (CID 118497517) is 7-(3-methylmorpholin-4-yl)-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine.
What is the SMILES notation for 7-(3-methylmorpholin-4-yl)-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine?
The canonical SMILES for 7-(3-methylmorpholin-4-yl)-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine is CC(C)c1cnnc(Nc2ccc3ncc(N4CCOCC4C)cc3n2)c1.
What is the InChIKey of 7-(3-methylmorpholin-4-yl)-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine?
The InChIKey is WNVTUOMRZWNUPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N6O/c1-13(2)15-8-20(25-22-10-15)24-19-5-4-17-18(23-19)9-16(11-21-17)26-6-7-27-12-14(26)3/h4-5,8-11,13-14H,6-7,12H2,1-3H3,(H,23,24,25).
What are the key properties of 7-(3-methylmorpholin-4-yl)-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine?
7-(3-methylmorpholin-4-yl)-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine has a molecular weight of 364.45 g/mol, XLogP of 3.51, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-methylmorpholin-4-yl)-N-(5-propan-2-ylpyridazin-3-yl)-1,5-naphthyridin-2-amine is sourced from PubChem (CID 118497517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).