C9H10N2O2 — CID 175399204
5-(3-aminoprop-2-enyl)pyridine-2-carboxylic acid (PubChem CID 175399204) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 5-(3-aminoprop-2-enyl)pyridine-2-carboxylic acid.
| Compound Name | 5-(3-aminoprop-2-enyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 175399204 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 5-(3-aminoprop-2-enyl)pyridine-2-carboxylic acid |
| SMILES | NC=CCc1ccc(C(=O)O)nc1 |
| InChI | InChI=1S/C9H10N2O2/c10-5-1-2-7-3-4-8(9(12)13)11-6-7/h1,3-6H,2,10H2,(H,12,13) |
| InChIKey | RBYNGBOEHYMJLE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |