About bis(5-butylpyridine-2-carboxylic acid);copper(1+)
bis(5-butylpyridine-2-carboxylic acid);copper(1+) (PubChem CID 42613105) has the molecular formula C20H26CuN2O4+
and a molecular weight of 421.98 g/mol. Its IUPAC name is bis(5-butylpyridine-2-carboxylic acid);copper(1+).
Molecular Properties
| Compound Name | bis(5-butylpyridine-2-carboxylic acid);copper(1+) |
| PubChem CID | 42613105 |
| Molecular Formula | C20H26CuN2O4+ |
| Molecular Weight | 421.98 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | bis(5-butylpyridine-2-carboxylic acid);copper(1+) |
| SMILES | CCCCc1ccc(C(=O)O)nc1.CCCCc1ccc(C(=O)O)nc1.[Cu+] |
| InChI | InChI=1S/2C10H13NO2.Cu/c2*1-2-3-4-8-5-6-9(10(12)13)11-7-8;/h2*5-7H,2-4H2,1H3,(H,12,13);/q;;+1 |
| InChIKey | BVJXTBGAXFGSGZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.98 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(5-butylpyridine-2-carboxylic acid);copper(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(5-butylpyridine-2-carboxylic acid);copper(1+)?
The IUPAC name of bis(5-butylpyridine-2-carboxylic acid);copper(1+) (CID 42613105) is bis(5-butylpyridine-2-carboxylic acid);copper(1+).
What is the SMILES notation for bis(5-butylpyridine-2-carboxylic acid);copper(1+)?
The canonical SMILES for bis(5-butylpyridine-2-carboxylic acid);copper(1+) is CCCCc1ccc(C(=O)O)nc1.CCCCc1ccc(C(=O)O)nc1.[Cu+].
What is the InChIKey of bis(5-butylpyridine-2-carboxylic acid);copper(1+)?
The InChIKey is BVJXTBGAXFGSGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H13NO2.Cu/c2*1-2-3-4-8-5-6-9(10(12)13)11-7-8;/h2*5-7H,2-4H2,1H3,(H,12,13);/q;;+1.
What are the key properties of bis(5-butylpyridine-2-carboxylic acid);copper(1+)?
bis(5-butylpyridine-2-carboxylic acid);copper(1+) has a molecular weight of 421.98 g/mol, XLogP of 4.24, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(5-butylpyridine-2-carboxylic acid);copper(1+) is sourced from PubChem (CID 42613105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).