C17H18N2O4 — CID 172619009
4-[(5-butylpyridine-2-carbonyl)amino]-2-hydroxybenzoic acid (PubChem CID 172619009) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 4-[(5-butylpyridine-2-carbonyl)amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[(5-butylpyridine-2-carbonyl)amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 172619009 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 4-[(5-butylpyridine-2-carbonyl)amino]-2-hydroxybenzoic acid |
| SMILES | CCCCc1ccc(C(=O)Nc2ccc(C(=O)O)c(O)c2)nc1 |
| InChI | InChI=1S/C17H18N2O4/c1-2-3-4-11-5-8-14(18-10-11)16(21)19-12-6-7-13(17(22)23)15(20)9-12/h5-10,20H,2-4H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | RPTSXPVYXZGFQY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |