C18H21ClN2O4 — CID 172618946
2-hydroxy-4-[(5-pentylpyridine-2-carbonyl)amino]benzoic acid;hydrochloride (PubChem CID 172618946) has the molecular formula C18H21ClN2O4 and a molecular weight of 364.83 g/mol. Its IUPAC name is 2-hydroxy-4-[(5-pentylpyridine-2-carbonyl)amino]benzoic acid;hydrochloride.
| Compound Name | 2-hydroxy-4-[(5-pentylpyridine-2-carbonyl)amino]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 172618946 |
| Molecular Formula | C18H21ClN2O4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-hydroxy-4-[(5-pentylpyridine-2-carbonyl)amino]benzoic acid;hydrochloride |
| SMILES | CCCCCc1ccc(C(=O)Nc2ccc(C(=O)O)c(O)c2)nc1.Cl |
| InChI | InChI=1S/C18H20N2O4.ClH/c1-2-3-4-5-12-6-9-15(19-11-12)17(22)20-13-7-8-14(18(23)24)16(21)10-13;/h6-11,21H,2-5H2,1H3,(H,20,22)(H,23,24);1H |
| InChIKey | KZOFMPQGLGCVGJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|