About 2-aminoethyl 5-butylpyridine-2-carboxylate
2-aminoethyl 5-butylpyridine-2-carboxylate (PubChem CID 54300012) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-aminoethyl 5-butylpyridine-2-carboxylate.
Molecular Properties
| Compound Name | 2-aminoethyl 5-butylpyridine-2-carboxylate |
| PubChem CID | 54300012 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-aminoethyl 5-butylpyridine-2-carboxylate |
| SMILES | CCCCc1ccc(C(=O)OCCN)nc1 |
| InChI | InChI=1S/C12H18N2O2/c1-2-3-4-10-5-6-11(14-9-10)12(15)16-8-7-13/h5-6,9H,2-4,7-8,13H2,1H3 |
| InChIKey | SDNGXZBBBIFRTD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-aminoethyl 5-butylpyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl 5-butylpyridine-2-carboxylate?
The IUPAC name of 2-aminoethyl 5-butylpyridine-2-carboxylate (CID 54300012) is 2-aminoethyl 5-butylpyridine-2-carboxylate.
What is the SMILES notation for 2-aminoethyl 5-butylpyridine-2-carboxylate?
The canonical SMILES for 2-aminoethyl 5-butylpyridine-2-carboxylate is CCCCc1ccc(C(=O)OCCN)nc1.
What is the InChIKey of 2-aminoethyl 5-butylpyridine-2-carboxylate?
The InChIKey is SDNGXZBBBIFRTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2/c1-2-3-4-10-5-6-11(14-9-10)12(15)16-8-7-13/h5-6,9H,2-4,7-8,13H2,1H3.
What are the key properties of 2-aminoethyl 5-butylpyridine-2-carboxylate?
2-aminoethyl 5-butylpyridine-2-carboxylate has a molecular weight of 222.29 g/mol, XLogP of 1.54, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl 5-butylpyridine-2-carboxylate is sourced from PubChem (CID 54300012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).