About 3-methoxypropyl 5-(aminomethyl)pyridine-2-carboxylate
3-methoxypropyl 5-(aminomethyl)pyridine-2-carboxylate (PubChem CID 81100505) has the molecular formula C11H16N2O3
and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-methoxypropyl 5-(aminomethyl)pyridine-2-carboxylate.
Molecular Properties
| Compound Name | 3-methoxypropyl 5-(aminomethyl)pyridine-2-carboxylate |
| PubChem CID | 81100505 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 3-methoxypropyl 5-(aminomethyl)pyridine-2-carboxylate |
| SMILES | COCCCOC(=O)c1ccc(CN)cn1 |
| InChI | InChI=1S/C11H16N2O3/c1-15-5-2-6-16-11(14)10-4-3-9(7-12)8-13-10/h3-4,8H,2,5-7,12H2,1H3 |
| InChIKey | WSDAHXRZQVAOQN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxypropyl 5-(aminomethyl)pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxypropyl 5-(aminomethyl)pyridine-2-carboxylate?
The IUPAC name of 3-methoxypropyl 5-(aminomethyl)pyridine-2-carboxylate (CID 81100505) is 3-methoxypropyl 5-(aminomethyl)pyridine-2-carboxylate.
What is the SMILES notation for 3-methoxypropyl 5-(aminomethyl)pyridine-2-carboxylate?
The canonical SMILES for 3-methoxypropyl 5-(aminomethyl)pyridine-2-carboxylate is COCCCOC(=O)c1ccc(CN)cn1.
What is the InChIKey of 3-methoxypropyl 5-(aminomethyl)pyridine-2-carboxylate?
The InChIKey is WSDAHXRZQVAOQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3/c1-15-5-2-6-16-11(14)10-4-3-9(7-12)8-13-10/h3-4,8H,2,5-7,12H2,1H3.
What are the key properties of 3-methoxypropyl 5-(aminomethyl)pyridine-2-carboxylate?
3-methoxypropyl 5-(aminomethyl)pyridine-2-carboxylate has a molecular weight of 224.26 g/mol, XLogP of 0.73, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxypropyl 5-(aminomethyl)pyridine-2-carboxylate is sourced from PubChem (CID 81100505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).