C20H27NO5 — CID 175483643
(E)-4-[7-(5-butyl-2-pyridinyl)-7-oxoheptoxy]-4-oxobut-2-enoic acid (PubChem CID 175483643) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is (E)-4-[7-(5-butyl-2-pyridinyl)-7-oxoheptoxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[7-(5-butyl-2-pyridinyl)-7-oxoheptoxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 175483643 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | (E)-4-[7-(5-butyl-2-pyridinyl)-7-oxoheptoxy]-4-oxobut-2-enoic acid |
| SMILES | CCCCc1ccc(C(=O)CCCCCCOC(=O)/C=C/C(=O)O)nc1 |
| InChI | InChI=1S/C20H27NO5/c1-2-3-8-16-10-11-17(21-15-16)18(22)9-6-4-5-7-14-26-20(25)13-12-19(23)24/h10-13,15H,2-9,14H2,1H3,(H,23,24)/b13-12+ |
| InChIKey | TYPWPPJIHJLHLQ-OUKQBFOZSA-N |
| XLogP | 3.74 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|