C22H23FN4O2 — CID 149016975
2-[3-[3-fluoro-4-(oxan-4-yloxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-3-methyliminoprop-1-en-1-amine (PubChem CID 149016975) has the molecular formula C22H23FN4O2 and a molecular weight of 394.45 g/mol. Its IUPAC name is 2-[3-[3-fluoro-4-(oxan-4-yloxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-3-methyliminoprop-1-en-1-amine.
| Compound Name | 2-[3-[3-fluoro-4-(oxan-4-yloxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-3-methyliminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 149016975 |
| Molecular Formula | C22H23FN4O2 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 2-[3-[3-fluoro-4-(oxan-4-yloxy)phenyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-3-methyliminoprop-1-en-1-amine |
| SMILES | C/N=C/C(=CN)c1cnc2[nH]cc(-c3ccc(OC4CCOCC4)c(F)c3)c2c1 |
| InChI | InChI=1S/C22H23FN4O2/c1-25-11-16(10-24)15-8-18-19(13-27-22(18)26-12-15)14-2-3-21(20(23)9-14)29-17-4-6-28-7-5-17/h2-3,8-13,17H,4-7,24H2,1H3,(H,26,27)/b16-10?,25-11+ |
| InChIKey | APELTBSWPRFSPV-KZUQARSSSA-N |
| XLogP | 3.93 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|