C26H26N6O2 — CID 173470533
5-[2-[4-(1-amino-3-methyliminoprop-1-en-2-yl)anilino]pyrimidin-4-yl]-2-(oxan-4-yloxy)benzonitrile (PubChem CID 173470533) has the molecular formula C26H26N6O2 and a molecular weight of 454.53 g/mol. Its IUPAC name is 5-[2-[4-(1-amino-3-methyliminoprop-1-en-2-yl)anilino]pyrimidin-4-yl]-2-(oxan-4-yloxy)benzonitrile.
| Compound Name | 5-[2-[4-(1-amino-3-methyliminoprop-1-en-2-yl)anilino]pyrimidin-4-yl]-2-(oxan-4-yloxy)benzonitrile |
|---|---|
| PubChem CID | 173470533 |
| Molecular Formula | C26H26N6O2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 5-[2-[4-(1-amino-3-methyliminoprop-1-en-2-yl)anilino]pyrimidin-4-yl]-2-(oxan-4-yloxy)benzonitrile |
| SMILES | C/N=C/C(=CN)c1ccc(Nc2nccc(-c3ccc(OC4CCOCC4)c(C#N)c3)n2)cc1 |
| InChI | InChI=1S/C26H26N6O2/c1-29-17-21(16-28)18-2-5-22(6-3-18)31-26-30-11-8-24(32-26)19-4-7-25(20(14-19)15-27)34-23-9-12-33-13-10-23/h2-8,11,14,16-17,23H,9-10,12-13,28H2,1H3,(H,30,31,32)/b21-16?,29-17+ |
| InChIKey | SXHYENSQLSCGDM-XJVAXNAHSA-N |
| XLogP | 4.32 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|