C20H18N6O3 — CID 71295114
2-(oxan-4-yloxy)-5-[2-[(6-oxo-1H-pyridazin-3-yl)amino]pyrimidin-4-yl]benzonitrile (PubChem CID 71295114) has the molecular formula C20H18N6O3 and a molecular weight of 390.40 g/mol. Its IUPAC name is 2-(oxan-4-yloxy)-5-[2-[(6-oxo-1H-pyridazin-3-yl)amino]pyrimidin-4-yl]benzonitrile.
| Compound Name | 2-(oxan-4-yloxy)-5-[2-[(6-oxo-1H-pyridazin-3-yl)amino]pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 71295114 |
| Molecular Formula | C20H18N6O3 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 2-(oxan-4-yloxy)-5-[2-[(6-oxo-1H-pyridazin-3-yl)amino]pyrimidin-4-yl]benzonitrile |
| SMILES | N#Cc1cc(-c2ccnc(Nc3ccc(=O)[nH]n3)n2)ccc1OC1CCOCC1 |
| InChI | InChI=1S/C20H18N6O3/c21-12-14-11-13(1-2-17(14)29-15-6-9-28-10-7-15)16-5-8-22-20(23-16)24-18-3-4-19(27)26-25-18/h1-5,8,11,15H,6-7,9-10H2,(H,26,27)(H,22,23,24,25) |
| InChIKey | FNKYBCOJEZQTSI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |