C26H28N6O6 — CID 166583962
6-[[4-[3-cyano-4-(oxan-4-yloxy)phenyl]pyrimidin-2-yl]amino]-N-(1,1-dihydroxypropyl)-2-methoxypyridine-3-carboxamide (PubChem CID 166583962) has the molecular formula C26H28N6O6 and a molecular weight of 520.55 g/mol. Its IUPAC name is 6-[[4-[3-cyano-4-(oxan-4-yloxy)phenyl]pyrimidin-2-yl]amino]-N-(1,1-dihydroxypropyl)-2-methoxypyridine-3-carboxamide.
| Compound Name | 6-[[4-[3-cyano-4-(oxan-4-yloxy)phenyl]pyrimidin-2-yl]amino]-N-(1,1-dihydroxypropyl)-2-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 166583962 |
| Molecular Formula | C26H28N6O6 |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 6-[[4-[3-cyano-4-(oxan-4-yloxy)phenyl]pyrimidin-2-yl]amino]-N-(1,1-dihydroxypropyl)-2-methoxypyridine-3-carboxamide |
| SMILES | CCC(O)(O)NC(=O)c1ccc(Nc2nccc(-c3ccc(OC4CCOCC4)c(C#N)c3)n2)nc1OC |
| InChI | InChI=1S/C26H28N6O6/c1-3-26(34,35)32-23(33)19-5-7-22(30-24(19)36-2)31-25-28-11-8-20(29-25)16-4-6-21(17(14-16)15-27)38-18-9-12-37-13-10-18/h4-8,11,14,18,34-35H,3,9-10,12-13H2,1-2H3,(H,32,33)(H,28,29,30,31) |
| InChIKey | ICWDKWUHJZKLNE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 171.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|