C24H23N5O4 — CID 67114623
4-[[4-[3-cyano-4-(oxan-4-yloxy)phenyl]pyrimidin-2-yl]amino]-2-methoxybenzamide (PubChem CID 67114623) has the molecular formula C24H23N5O4 and a molecular weight of 445.48 g/mol. Its IUPAC name is 4-[[4-[3-cyano-4-(oxan-4-yloxy)phenyl]pyrimidin-2-yl]amino]-2-methoxybenzamide.
| Compound Name | 4-[[4-[3-cyano-4-(oxan-4-yloxy)phenyl]pyrimidin-2-yl]amino]-2-methoxybenzamide |
|---|---|
| PubChem CID | 67114623 |
| Molecular Formula | C24H23N5O4 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 4-[[4-[3-cyano-4-(oxan-4-yloxy)phenyl]pyrimidin-2-yl]amino]-2-methoxybenzamide |
| SMILES | COc1cc(Nc2nccc(-c3ccc(OC4CCOCC4)c(C#N)c3)n2)ccc1C(N)=O |
| InChI | InChI=1S/C24H23N5O4/c1-31-22-13-17(3-4-19(22)23(26)30)28-24-27-9-6-20(29-24)15-2-5-21(16(12-15)14-25)33-18-7-10-32-11-8-18/h2-6,9,12-13,18H,7-8,10-11H2,1H3,(H2,26,30)(H,27,28,29) |
| InChIKey | DUWNBOQVZCECEU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |