C22H21N5O2 — CID 67114718
5-[2-(4-aminoanilino)pyrimidin-4-yl]-2-(oxan-4-yloxy)benzonitrile (PubChem CID 67114718) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 5-[2-(4-aminoanilino)pyrimidin-4-yl]-2-(oxan-4-yloxy)benzonitrile.
| Compound Name | 5-[2-(4-aminoanilino)pyrimidin-4-yl]-2-(oxan-4-yloxy)benzonitrile |
|---|---|
| PubChem CID | 67114718 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 5-[2-(4-aminoanilino)pyrimidin-4-yl]-2-(oxan-4-yloxy)benzonitrile |
| SMILES | N#Cc1cc(-c2ccnc(Nc3ccc(N)cc3)n2)ccc1OC1CCOCC1 |
| InChI | InChI=1S/C22H21N5O2/c23-14-16-13-15(1-6-21(16)29-19-8-11-28-12-9-19)20-7-10-25-22(27-20)26-18-4-2-17(24)3-5-18/h1-7,10,13,19H,8-9,11-12,24H2,(H,25,26,27) |
| InChIKey | VJFNZKPXRNKPOE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|